cas: 676348-33-7 — see every product listed under this CAS number, including other names
2'-Fluorobiphenyl-3-carbaldehyde (CAS 676348-33-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014305-100MG |
| cas | 676348-33-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 1924.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
3-(2-fluorophenyl)benzaldehyde (CAS 676348-33-7) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 3-(2-fluorophenyl)benzaldehyde. InChIKey: JEZDTHCXEQVVLE-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 3-(2-fluorophenyl)benzaldehyde |
| InChIKey | JEZDTHCXEQVVLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC(=C2)C=O)F |
Computed by PubChem (NCBI)