CAS 1508348-13-7 is the registry number for 2-Fluoro-3-phenylbenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-fluoro-3-phenylbenzaldehyde (CAS 1508348-13-7) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 2-fluoro-3-phenylbenzaldehyde. InChIKey: SGVGWXZEVVBIAL-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-fluoro-3-phenylbenzaldehyde |
| InChIKey | SGVGWXZEVVBIAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2F)C=O |
Computed by PubChem (NCBI)