CAS 183436-80-8 appears in our catalog under these names: 2-Fluoro-4-phenylbenzaldehyde, 98%, 2-Fluoro-4-phenylbenzaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 2,5g, 250mg.
2-fluoro-4-phenylbenzaldehyde (CAS 183436-80-8) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 2-fluoro-4-phenylbenzaldehyde. InChIKey: LMELGNCEEYDIED-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-fluoro-4-phenylbenzaldehyde |
| InChIKey | LMELGNCEEYDIED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C=O)F |
Computed by PubChem (NCBI)