CAS 345-69-7 appears in our catalog under these names: 3-Fluorobenzophenone, 98%, 3-Fluorobenzophenone, 3-Fluorobenzophenone, 98%, 98%, 3-Fluorobenzophenone, 97%, (3-Fluorophenyl)(phenyl)methanone, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 50g.
(3-fluorophenyl)-phenylmethanone (CAS 345-69-7) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: (3-fluorophenyl)-phenylmethanone. InChIKey: NCIYZALOQBXNLW-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | (3-fluorophenyl)-phenylmethanone |
| InChIKey | NCIYZALOQBXNLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)