2'-O-Methyladenosine, 98%
cas: 2140-79-6 — see every product listed under this CAS number, including other names
2'-O-Methyladenosine, 98% (CAS 2140-79-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F225617-100MG |
| cas | 2140-79-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 117.68 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 555.03 Pln | |
| Fluorochem | 10g | 966.34 Pln | |
| Fluorochem | 25g | 1726.49 Pln | |
| Fluorochem | 100g | 4178.75 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 570.62 Pln | |
| Ambeed | 25g | 1761.00 Pln | |
| Ambeed | 100g | 4147.31 Pln | |
| Ambeed | 500g | 12296.38 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 50g | 784.40 Pln | |
| Chemat | 100g | 1442.00 Pln | |
| Chemat | 500g | 2928.00 Pln | |
| Chemat | 1kg | 4605.20 Pln | |
| Chemat | 5kg | 19665.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Cordysinin B is a member of the class of adenosines that is adenosine in which the hydroxy group at position 2' is replaced by a methoxy group. It has been isolated from the mycelia of Cordyceps sinensis. It has a role as a fungal metabolite. It is a member of adenosines and an ether. It is functionally related to an adenosine.
Source: ChEBI
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
| InChIKey | FPUGCISOLXNPPC-IOSLPCCCSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O |
Computed by PubChem (NCBI)
Synonyms:
2'-O-Methyladenosine, Adenosine, 2'-O-methyl-, (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol, 5-(6-amino-9H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol, 2'-O-Methyl adenosine, cordysinin B, 2'-O-Me-A, 2 inverted exclamation marka-O-Methyladenosine, 2'-O-Methyl-D-adenosine, OMe-rA