CAS 99104-20-8 appears in our catalog under these names: O-6-Methyl-2'-deoxyguanosine-D3, >95% (HPLC), O-6-Methyl-2'-deoxyguanosine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 1 mg, 10 mg.
(2R,3S,5R)-5-[2-amino-6-(trideuteriomethoxy)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 99104-20-8) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 284.29 g/mol. IUPAC name: (2R,3S,5R)-5-[2-amino-6-(trideuteriomethoxy)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: BCKDNMPYCIOBTA-LUGGGHJKSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | (2R,3S,5R)-5-[2-amino-6-(trideuteriomethoxy)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | BCKDNMPYCIOBTA-LUGGGHJKSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC(=NC2=C1N=CN2[C@H]3C[C@@H]([C@H](O3)CO)O)N |
Computed by PubChem (NCBI)