Products 1195030-24-0
CAS 1195030-24-0 appears in our catalog under these names: 2'-O-Methyl Adenosine-d3, >95% (HPLC), 2'–O–Methyladenosine–d3, 2'-O-Methyladenosine-d3, 97.54%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 500μg, 2.5 mg.
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-(trideuteriomethoxy)oxolan-3-ol (CAS 1195030-24-0) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 284.29 g/mol. IUPAC name: (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-(trideuteriomethoxy)oxolan-3-ol. InChIKey: FPUGCISOLXNPPC-YZLHILBGSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-(trideuteriomethoxy)oxolan-3-ol |
| InChIKey | FPUGCISOLXNPPC-YZLHILBGSA-N |
| SMILES | [2H]C([2H])([2H])O[C@@H]1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O |
Computed by PubChem (NCBI)
Synonyms:
2'-O-Methyl Adenosine-d3