CAS 139896-43-8 appears in our catalog under these names: N6-Methyladenosine-d3, >95% (HPLC), N6–Methyladenosine–d3, N6-Methyladenosine-d3, N6-Methyladenosine-d3, 99.97%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 1mg, 10mg, 50mg, 5 mg, 1 mg.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(trideuteriomethylamino)purin-9-yl]oxolane-3,4-diol (CAS 139896-43-8) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 284.29 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(trideuteriomethylamino)purin-9-yl]oxolane-3,4-diol. InChIKey: VQAYFKKCNSOZKM-YZLHILBGSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(trideuteriomethylamino)purin-9-yl]oxolane-3,4-diol |
| InChIKey | VQAYFKKCNSOZKM-YZLHILBGSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)