cas: 198205-95-7 — see every product listed under this CAS number, including other names
2'-Trifluoromethylbiphenyl-4-carbaldehyde (CAS 198205-95-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014312-250MG |
| cas | 198205-95-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 247.85 Pln |
| delivery time | 3-4 weeks |
|---|
4-[2-(trifluoromethyl)phenyl]benzaldehyde (CAS 198205-95-7) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: SDDRLRQYSYHJED-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | SDDRLRQYSYHJED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C=O)C(F)(F)F |
Computed by PubChem (NCBI)