CAS 187617-93-2 appears in our catalog under these names: 2–(2,4–difluorophenyl)–1–(4–fluorophenyl)ethanone, 2-(2,4-Difluorophenyl)-1-(4-fluorophenyl)ethanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-(2,4-difluorophenyl)-1-(4-fluorophenyl)ethanone (CAS 187617-93-2) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-1-(4-fluorophenyl)ethanone. InChIKey: XJLVTVJENFBUPN-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-1-(4-fluorophenyl)ethanone |
| InChIKey | XJLVTVJENFBUPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC2=C(C=C(C=C2)F)F)F |
Computed by PubChem (NCBI)