Products 1483427-28-6
CAS 1483427-28-6 is the registry number for 2-(2,4-Difluorophenyl)-1-(2-fluorophenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2,4-difluorophenyl)-1-(2-fluorophenyl)ethanone (CAS 1483427-28-6) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-1-(2-fluorophenyl)ethanone. InChIKey: DGXKXRXYJDPLEA-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-1-(2-fluorophenyl)ethanone |
| InChIKey | DGXKXRXYJDPLEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC2=C(C=C(C=C2)F)F)F |
Computed by PubChem (NCBI)