CAS 1507249-35-5 is the registry number for 2-(3,4-Difluorophenyl)-1-(4-fluorophenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethanone (CAS 1507249-35-5) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethanone. InChIKey: PCCJXDXDWCFLNV-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethanone |
| InChIKey | PCCJXDXDWCFLNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC2=CC(=C(C=C2)F)F)F |
Computed by PubChem (NCBI)