cas: 53344-74-4 — see every product listed under this CAS number, including other names
2,2'-Dichloro-4,4'-bipyridine (CAS 53344-74-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114FAF-5g |
| cas | 53344-74-4 |
| size | 5g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 19763.60 Pln | |
| Fluorochem | 100mg | 1039.24 Pln |
| delivery time | 3 weeks |
|---|
2-chloro-4-(2-chloro-4-pyridinyl)pyridine (CAS 53344-74-4) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 2-chloro-4-(2-chloro-4-pyridinyl)pyridine. InChIKey: KSELKNWXBOXHEV-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2-chloro-4-(2-chloro-4-pyridinyl)pyridine |
| InChIKey | KSELKNWXBOXHEV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C2=CC(=NC=C2)Cl)Cl |
Computed by PubChem (NCBI)