CAS 53344-74-4 appears in our catalog under these names: 2,2'-Dichloro-4,4'-bipyridine, 95%, 2,2'-Dichloro-4,4'-bipyridine. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g.
2-chloro-4-(2-chloro-4-pyridinyl)pyridine (CAS 53344-74-4) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 2-chloro-4-(2-chloro-4-pyridinyl)pyridine. InChIKey: KSELKNWXBOXHEV-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2-chloro-4-(2-chloro-4-pyridinyl)pyridine |
| InChIKey | KSELKNWXBOXHEV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C2=CC(=NC=C2)Cl)Cl |
Computed by PubChem (NCBI)