CAS 66548-94-5 is the registry number for 3-Chloro-6-(3-chlorophenyl)pyridazine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 250mg, 1g, 5g.
3-chloro-6-(3-chlorophenyl)pyridazine (CAS 66548-94-5) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 3-chloro-6-(3-chlorophenyl)pyridazine. InChIKey: QRFJVCQGPISREA-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 3-chloro-6-(3-chlorophenyl)pyridazine |
| InChIKey | QRFJVCQGPISREA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)