CAS 58059-29-3 appears in our catalog under these names: 3-Chloro-6-(4-chlorophenyl)pyridazine, 95%, 3-Chloro-6-(4-chlorophenyl)pyridazine, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
3-chloro-6-(4-chlorophenyl)pyridazine (CAS 58059-29-3) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 3-chloro-6-(4-chlorophenyl)pyridazine. InChIKey: ARQKIDKGCMDXKY-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 3-chloro-6-(4-chlorophenyl)pyridazine |
| InChIKey | ARQKIDKGCMDXKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)