cas: 5950-69-6 — see every product listed under this CAS number, including other names
2,2'-Dihydroxy-1H,1'H-[2,2'-biindene]-1,1',3,3'(2H,2'H)-tetraone dihydrate, 98%, 98% (CAS 5950-69-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QYK-250mg |
| cas | 5950-69-6 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 25g | 952.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one (CAS 5950-69-6) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one. InChIKey: QHVADKNWNMILPQ-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one |
| InChIKey | QHVADKNWNMILPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2(O)O)(C3(C(=O)C4=CC=CC=C4C3(O)O)O)O |
Computed by PubChem (NCBI)