cas: 5950-69-6 — see every product listed under this CAS number, including other names
Hydrindantin dihydrate 98% (CAS 5950-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A959889-100g |
| cas | 5950-69-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 4531.12 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1460.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A959889 |
2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one (CAS 5950-69-6) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one. InChIKey: QHVADKNWNMILPQ-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one |
| InChIKey | QHVADKNWNMILPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2(O)O)(C3(C(=O)C4=CC=CC=C4C3(O)O)O)O |
Computed by PubChem (NCBI)