cas: 5950-69-6 — see every product listed under this CAS number, including other names
Hydrindantin dihydrate, 96% (CAS 5950-69-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 250g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 159280100 |
| cas | 5950-69-6 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 268.16 Pln | |
| Thermo Scientific (Acros) | 50g | 899.80 Pln | |
| Thermo Scientific (Acros) | 250g | 3643.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 96% |
2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one (CAS 5950-69-6) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one. InChIKey: QHVADKNWNMILPQ-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one |
| InChIKey | QHVADKNWNMILPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2(O)O)(C3(C(=O)C4=CC=CC=C4C3(O)O)O)O |
Computed by PubChem (NCBI)