CAS 5950-69-6 appears in our catalog under these names: 2,2',3,3,3',3'-Hexahydroxy-2,2',3,3'-tetrahydro-1h,1'h-2,2'-biindene-1,1'-dione, 95%, Hydrindantin dihydrate, Hydrindantin hydrate, Hydrindantin dihydrate, 96%, Hydrindantin dihydrate, 97.00%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 50g, 250g, 100g, 250mg.
2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one (CAS 5950-69-6) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one. InChIKey: QHVADKNWNMILPQ-UHFFFAOYSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2,3,3-trihydroxy-2-(1,1,2-trihydroxy-3-oxoinden-2-yl)inden-1-one |
| InChIKey | QHVADKNWNMILPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2(O)O)(C3(C(=O)C4=CC=CC=C4C3(O)O)O)O |
Computed by PubChem (NCBI)