2,2'-Thiobis(4-chlorophenol)
cas: 97-24-5 — see every product listed under this CAS number, including other names
2,2'-Thiobis(4-chlorophenol) (CAS 97-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114O9N-1g |
| cas | 97-24-5 |
| size | 1g |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 25g | 419.60 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 25g | 976.76 Pln |
properties
| delivery time | 3 weeks |
|---|
Fenticlor is an aryl sulfide having two 5-chloro-2-hydroxyphenyl groups attached to sulfur; an antiinfective drug mostly used in veterinary medicine. It has a role as an antiinfective agent and a drug allergen. It is a polyphenol, an aryl sulfide, a member of monochlorobenzenes and a bridged diphenyl antifungal drug.
Source: ChEBI
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol |
| InChIKey | ANUSOIHIIPAHJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)SC2=C(C=CC(=C2)Cl)O)O |
Computed by PubChem (NCBI)