Products 887344-37-8

CAS 887344-37-8 appears in our catalog under these names: [2-(4-Chlorophenyl)phenyl]sulfonyl chloride, 95%, (2-(4-Chlorophenyl)phenyl)sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(4-chlorophenyl)benzenesulfonyl chloride (CAS 887344-37-8) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 2-(4-chlorophenyl)benzenesulfonyl chloride. InChIKey: FYMAPVBLPAOFMP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl2O2S
Molecular weight287.2 g/mol
IUPAC name2-(4-chlorophenyl)benzenesulfonyl chloride
InChIKeyFYMAPVBLPAOFMP-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)