CAS 887344-37-8 appears in our catalog under these names: [2-(4-Chlorophenyl)phenyl]sulfonyl chloride, 95%, (2-(4-Chlorophenyl)phenyl)sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-(4-chlorophenyl)benzenesulfonyl chloride (CAS 887344-37-8) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 2-(4-chlorophenyl)benzenesulfonyl chloride. InChIKey: FYMAPVBLPAOFMP-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 2-(4-chlorophenyl)benzenesulfonyl chloride |
| InChIKey | FYMAPVBLPAOFMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)