CAS 478647-00-6 appears in our catalog under these names: 3'-Chloro-[1,1'-biphenyl]-4-sulfonyl chloride, 95%, 3'-Chloro-(1,1'-biphenyl)-4-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
4-(3-chlorophenyl)benzenesulfonyl chloride (CAS 478647-00-6) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 4-(3-chlorophenyl)benzenesulfonyl chloride. InChIKey: FVELIXWAKJVRDG-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 4-(3-chlorophenyl)benzenesulfonyl chloride |
| InChIKey | FVELIXWAKJVRDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)