CAS 20443-74-7 appears in our catalog under these names: 4'-Chloro[1,1'-biphenyl]-4-sulfonyl chloride, 95%, 4′–Chlorobiphenyl–4–sulfonyl chloride, 4'-Chlorobiphenyl-4-sulfonyl chloride, 96% , 4'-Chlorobiphenyl-4-sulfonyl chloride, 97%, 4'-Chloro[1,1'-biphenyl]-4-sulfonyl chloride, 97% . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Thermo Scientific. Available pack sizes: 5g, 1g, 250mg, 10g.
4-(4-chlorophenyl)benzenesulfonyl chloride (CAS 20443-74-7) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 4-(4-chlorophenyl)benzenesulfonyl chloride. InChIKey: NWYUSJMIHFIMTA-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 4-(4-chlorophenyl)benzenesulfonyl chloride |
| InChIKey | NWYUSJMIHFIMTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)