cas: 124004-75-7 — see every product listed under this CAS number, including other names
2,2,2,2'-Tetrafluoroacetophenone, 98% (CAS 124004-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043106-250MG |
| cas | 124004-75-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 500mg | 195.78 Pln | |
| Fluorochem | 1g | 331.15 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,2,2-trifluoro-1-(2-fluorophenyl)ethanone (CAS 124004-75-7) is a chemical compound with the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluorophenyl)ethanone. InChIKey: NVSKOJZXIQFFBQ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O |
|---|---|
| Molecular weight | 192.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluorophenyl)ethanone |
| InChIKey | NVSKOJZXIQFFBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)