CAS 124004-75-7 appears in our catalog under these names: 2,2,2,2'-Tetrafluoroacetophenone, 95%, 2,2,2-Trifluoro-1-(2-fluorophenyl)ethanone 97%, 2,2,2,2'-Tetrafluoroacetophenone, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 500mg.
2,2,2-trifluoro-1-(2-fluorophenyl)ethanone (CAS 124004-75-7) is a chemical compound with the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluorophenyl)ethanone. InChIKey: NVSKOJZXIQFFBQ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O |
|---|---|
| Molecular weight | 192.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluorophenyl)ethanone |
| InChIKey | NVSKOJZXIQFFBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)