CAS 368-94-5 appears in our catalog under these names: 4-(Trifluoromethyl)benzoyl fluoride, 95%, 4-(Trifluoromethyl)benzoyl fluoride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g.
4-(trifluoromethyl)benzoyl fluoride (CAS 368-94-5) is a chemical compound with the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. IUPAC name: 4-(trifluoromethyl)benzoyl fluoride. InChIKey: RULVRLLGHXQORW-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O |
|---|---|
| Molecular weight | 192.11 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzoyl fluoride |
| InChIKey | RULVRLLGHXQORW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)F)C(F)(F)F |
Computed by PubChem (NCBI)