Products 328-99-4
CAS 328-99-4 is the registry number for 3-(Trifluoromethyl)benzoyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-(trifluoromethyl)benzoyl fluoride (CAS 328-99-4) is a chemical compound with the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. IUPAC name: 3-(trifluoromethyl)benzoyl fluoride. InChIKey: LTHOSILCKUBBIS-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O |
|---|---|
| Molecular weight | 192.11 g/mol |
| IUPAC name | 3-(trifluoromethyl)benzoyl fluoride |
| InChIKey | LTHOSILCKUBBIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)F |
Computed by PubChem (NCBI)
Synonyms:
3-(Trifluoromethyl)benzoyl fluoride, m-Trifluoromethylbenzoyl fluoride, Benzoyl fluoride, 3-(trifluoromethyl)-, m-(Trifluoromethyl)benzoyl fluoride, m-Toluoyl fluoride, alpha,alpha,alpha-trifluoro-, m-Toluoyl fluoride, .alpha.,.alpha.,.alpha.-trifluoro-, m-Toluoyl fluoride, alpha,alpha,alpha-trifluoro-(8CI), 3-Trifluoromethyl-benzoyl fluoride, m-Toluoyl fluoride,.alpha.,.alpha.-trifluoro-, 3-(Trifluoromethyl)-benzoic acid fluoride