cas: 1220039-72-4 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride, 95% (CAS 1220039-72-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F622418-50MG |
| cas | 1220039-72-4 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 711.23 Pln | |
| Fluorochem | 100mg | 893.45 Pln | |
| Fluorochem | 250mg | 1054.85 Pln | |
| Fluorochem | 500mg | 1393.28 Pln | |
| Fluorochem | 1g | 2038.88 Pln | |
| Fluorochem | 5g | 6490.44 Pln | |
| Chemat | 50mg | 578.00 Pln | |
| Chemat | 100mg | 722.00 Pln | |
| Chemat | 250mg | 851.60 Pln | |
| Chemat | 500mg | 1115.60 Pln | |
| Chemat | 1g | 1643.60 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 1220039-72-4) is a chemical compound with the molecular formula C9H8ClF6N and a molecular weight of 279.61 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: KBJQMJLPMZXUCR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF6N |
|---|---|
| Molecular weight | 279.61 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | KBJQMJLPMZXUCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)