CAS 1391550-87-0 is the registry number for (S)-2,2,2-Trifluoro-1-(3-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 1391550-87-0) is a chemical compound with the molecular formula C9H8ClF6N and a molecular weight of 279.61 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: XFJJZYCPEXYDHF-FJXQXJEOSA-N.
| Molecular formula | C9H8ClF6N |
|---|---|
| Molecular weight | 279.61 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | XFJJZYCPEXYDHF-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)