CAS 336105-44-3 appears in our catalog under these names: Benzenemethanamine, α,4-bis(trifluoromethyl)-, hydrochloride (1:1), (αS)-, 97%, 97%, (S)-2,2,2-Trifluoro-1-(4-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 500mg, 1g.
(1S)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 336105-44-3) is a chemical compound with the molecular formula C9H8ClF6N and a molecular weight of 279.61 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: KBJQMJLPMZXUCR-FJXQXJEOSA-N.
| Molecular formula | C9H8ClF6N |
|---|---|
| Molecular weight | 279.61 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | KBJQMJLPMZXUCR-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)