CAS 1443981-34-7 is the registry number for 2,2,2-Trifluoro-1-(2-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 1443981-34-7) is a chemical compound with the molecular formula C9H8ClF6N and a molecular weight of 279.61 g/mol. IUPAC name: 2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: ANYUIDYOYOWCCS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF6N |
|---|---|
| Molecular weight | 279.61 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | ANYUIDYOYOWCCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)