cas: 403660-48-0 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(5-indazolyl)ethanone, 95% (CAS 403660-48-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A527541-5g |
| cas | 403660-48-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 26285.77 Pln | |
| AmBeed | 250mg | 5909.47 Pln | |
| AmBeed | 1g | 21735.28 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2,2-trifluoro-1-(1H-indazol-5-yl)ethanone (CAS 403660-48-0) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1H-indazol-5-yl)ethanone. InChIKey: UAZVGXXGCZPWGT-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1H-indazol-5-yl)ethanone |
| InChIKey | UAZVGXXGCZPWGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)C(F)(F)F)C=NN2 |
Computed by PubChem (NCBI)