Products 477886-85-4
CAS 477886-85-4 appears in our catalog under these names: 2-[4-(Trifluoromethyl)phenyl]-1,3,4-oxadiazole, 98%, 2-(4-(Trifluoromethyl)phenyl)-1,3,4-oxadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
2-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole (CAS 477886-85-4) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole. InChIKey: VIXOOTOYIUQAMC-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
| InChIKey | VIXOOTOYIUQAMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=CO2)C(F)(F)F |
Computed by PubChem (NCBI)