CAS 55687-18-8 is the registry number for 6-(Trifluoromethyl)-1H-quinoxalin-2-one, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(trifluoromethyl)-1H-quinoxalin-2-one (CAS 55687-18-8) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-quinoxalin-2-one. InChIKey: DJEISFASDVIILC-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-quinoxalin-2-one |
| InChIKey | DJEISFASDVIILC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=CC(=O)N2 |
Computed by PubChem (NCBI)