Products 113082-33-0
CAS 113082-33-0 is the registry number for 2(1H)-Quinazolinone, 6-(trifluoromethyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-(trifluoromethyl)-1H-quinazolin-2-one (CAS 113082-33-0) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-quinazolin-2-one. InChIKey: GZGQNFRHYZBRCW-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-quinazolin-2-one |
| InChIKey | GZGQNFRHYZBRCW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C=NC(=O)N2 |
Computed by PubChem (NCBI)