cas: 75999-66-5 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-N-(4-methoxyphenyl)acetimidoyl Chloride, >98.0%(GC)(T) (CAS 75999-66-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2638-5G |
| cas | 75999-66-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 1157.37 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl chloride (CAS 75999-66-5) is a chemical compound with the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. IUPAC name: 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl chloride. InChIKey: CIRVADWNFWYATJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO |
|---|---|
| Molecular weight | 237.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl chloride |
| InChIKey | CIRVADWNFWYATJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N=C(C(F)(F)F)Cl |
Computed by PubChem (NCBI)