cas: 75999-66-5 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-N-(4-methoxyphenyl)acetimidoyl chloride, 98%, 98% (CAS 75999-66-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F8D-100mg |
| cas | 75999-66-5 |
| size | 100mg |
| availability | 5.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 928.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl chloride (CAS 75999-66-5) is a chemical compound with the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. IUPAC name: 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl chloride. InChIKey: CIRVADWNFWYATJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO |
|---|---|
| Molecular weight | 237.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl chloride |
| InChIKey | CIRVADWNFWYATJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N=C(C(F)(F)F)Cl |
Computed by PubChem (NCBI)