cas: 1544-85-0 — see every product listed under this CAS number, including other names
2,2-Difluorobenzo[d][1,3]dioxol-5-amine 97% (CAS 1544-85-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122948-250mg |
| cas | 1544-85-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 565.06 Pln | |
| Ambeed | 500g | 1989.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122948 |
2,2-difluoro-1,3-benzodioxol-5-amine (CAS 1544-85-0) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: CVYQRDKVWVBOFP-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | CVYQRDKVWVBOFP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)OC(O2)(F)F |
Computed by PubChem (NCBI)