2,2-Difluorobenzo[d][1,3]dioxol-5-amine, 97%, 97%
cas: 1544-85-0 — see every product listed under this CAS number, including other names
2,2-Difluorobenzo[d][1,3]dioxol-5-amine, 97%, 97% (CAS 1544-85-0) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 10kg, 25kg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FAW-1kg |
| cas | 1544-85-0 |
| size | 1kg |
| availability | 25000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 3299.60 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request | |
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 371.60 Pln | |
| Chemat | 5kg | 10800.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,2-difluoro-1,3-benzodioxol-5-amine (CAS 1544-85-0) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: CVYQRDKVWVBOFP-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | CVYQRDKVWVBOFP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)OC(O2)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2,2-Difluorobenzo[d][1,3]dioxol-5-amine, 2,2-Difluoro-5-aminobenzodioxole, 2,2-difluoro-1,3-benzodioxol-5-amine, 2,2-Difluoro-5-amino-1,3-benzodioxole, 2,2-difluoro-5-aminobenzo[d][1,3]dioxole, 3,4-(difluoromethylenedioxy)aniline, 2,2-difluorobenzo[d]1,3-dioxolene-5-ylamine, 1,3-Benzodioxol-5-amine, 2,2-difluoro-, XBJLCOUCQBSNEA-UHFFFAOYSA-N, 2,2-difluoro-1,3-dioxaindan-5-amine