cas: 17432-38-1 — see every product listed under this CAS number, including other names
2,3,4,5,6-Pentamethylbenzaldehyde, 96%, 96% (CAS 17432-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 200mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ZMB-100mg |
| cas | 17432-38-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 200mg | 131.60 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 827.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2,3,4,5,6-pentamethylbenzaldehyde (CAS 17432-38-1) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 2,3,4,5,6-pentamethylbenzaldehyde. InChIKey: RWOZGGOKRKSHKN-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 2,3,4,5,6-pentamethylbenzaldehyde |
| InChIKey | RWOZGGOKRKSHKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)C=O)C)C |
Computed by PubChem (NCBI)