cas: 17432-38-1 — see every product listed under this CAS number, including other names
Pentamethylbenzaldehyde, >96.0%(GC) (CAS 17432-38-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P1351-1G |
| cas | 17432-38-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 437.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
2,3,4,5,6-pentamethylbenzaldehyde (CAS 17432-38-1) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 2,3,4,5,6-pentamethylbenzaldehyde. InChIKey: RWOZGGOKRKSHKN-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 2,3,4,5,6-pentamethylbenzaldehyde |
| InChIKey | RWOZGGOKRKSHKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)C=O)C)C |
Computed by PubChem (NCBI)