cas: 1028205-76-6 — see every product listed under this CAS number, including other names
2,3,4,5,6-Pentamethylphenylboronic Acid 95% (CAS 1028205-76-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130536-250mg |
| cas | 1028205-76-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2217.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A130536 |
(2,3,4,5,6-pentamethylphenyl)boronic acid (CAS 1028205-76-6) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: (2,3,4,5,6-pentamethylphenyl)boronic acid. InChIKey: UJTUQGRGYLGFBX-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | (2,3,4,5,6-pentamethylphenyl)boronic acid |
| InChIKey | UJTUQGRGYLGFBX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1C)C)C)C)C)(O)O |
Computed by PubChem (NCBI)