Products 1055879-22-5
CAS 1055879-22-5 appears in our catalog under these names: 2,3,4,5-Tetrahydro-1,4-benzoxazepine-9-carboxylic acid hydrochloride, 2,3,4,5-Tetrahydrobenzo[f][1,4]oxazepine-9-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 1g, 0,5g, 2g, 100mg, 250mg.
2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylic acid;hydrochloride (CAS 1055879-22-5) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylic acid;hydrochloride. InChIKey: MNRQVSJCUNAEIA-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 2,3,4,5-tetrahydro-1,4-benzoxazepine-9-carboxylic acid;hydrochloride |
| InChIKey | MNRQVSJCUNAEIA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(CN1)C=CC=C2C(=O)O.Cl |
Computed by PubChem (NCBI)