CAS 63617-98-1 appears in our catalog under these names: Methyl 4-[imino(methoxy)methyl]benzoate hydrochloride, 95%, Methyl 4–(Imino(methoxy)methyl)benzoate Hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g.
Methyl 4-(C-methoxycarbonimidoyl)benzoate;hydrochloride (CAS 63617-98-1) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: methyl 4-(C-methoxycarbonimidoyl)benzoate;hydrochloride. InChIKey: JBPPXFLNTLTIEP-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | methyl 4-(C-methoxycarbonimidoyl)benzoate;hydrochloride |
| InChIKey | JBPPXFLNTLTIEP-UHFFFAOYSA-N |
| SMILES | COC(=N)C1=CC=C(C=C1)C(=O)OC.Cl |
Computed by PubChem (NCBI)