CAS 873862-33-0 appears in our catalog under these names: Methyl 3,4-dihydro-2h-1,4-benzoxazine-8-carboxylate hydrochloride, 95%, Methyl 3,4–dihydro–2H–benzo(b)(1,4)oxazine–8–carboxylate hydrochloride, Methyl 3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylate, 95%, 95%, Methyl 3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3,4-dihydro-2H-1,4-benzoxazine-8-carboxylate;hydrochloride (CAS 873862-33-0) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: methyl 3,4-dihydro-2H-1,4-benzoxazine-8-carboxylate;hydrochloride. InChIKey: FEIWFQAVAJMOAG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | methyl 3,4-dihydro-2H-1,4-benzoxazine-8-carboxylate;hydrochloride |
| InChIKey | FEIWFQAVAJMOAG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)NCCO2.Cl |
Computed by PubChem (NCBI)