Products 1609395-67-6
CAS 1609395-67-6 appears in our catalog under these names: 4-(3-Azetidinyloxy)benzoic acid hydrochloride, 98%, 4-(3-Azetidinyloxy)benzoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2g, 10g.
4-(azetidin-3-yloxy)benzoic acid;hydrochloride (CAS 1609395-67-6) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 4-(azetidin-3-yloxy)benzoic acid;hydrochloride. InChIKey: BPCQYOZOTQUKSG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 4-(azetidin-3-yloxy)benzoic acid;hydrochloride |
| InChIKey | BPCQYOZOTQUKSG-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)