CAS 2176-63-8 appears in our catalog under these names: tetrachloropyridin–4–amine, 2,3,5,6-TETRACHLOROPYRIDIN-4-AMINE, 95+%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2,3,5,6-tetrachloropyridin-4-amine (CAS 2176-63-8) is a chemical compound with the molecular formula C5H2Cl4N2 and a molecular weight of 231.9 g/mol. IUPAC name: 2,3,5,6-tetrachloropyridin-4-amine. InChIKey: CPLQYBDXWJHBST-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl4N2 |
|---|---|
| Molecular weight | 231.9 g/mol |
| IUPAC name | 2,3,5,6-tetrachloropyridin-4-amine |
| InChIKey | CPLQYBDXWJHBST-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)Cl)Cl)N |
Computed by PubChem (NCBI)