CAS 51501-52-1 appears in our catalog under these names: 3,4,5,6-Tetrachloropyridin-2-amine, 98+%, Tetrachloropyridin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3,4,5,6-tetrachloropyridin-2-amine (CAS 51501-52-1) is a chemical compound with the molecular formula C5H2Cl4N2 and a molecular weight of 231.9 g/mol. IUPAC name: 3,4,5,6-tetrachloropyridin-2-amine. InChIKey: UNFHNOMCUBAGRI-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl4N2 |
|---|---|
| Molecular weight | 231.9 g/mol |
| IUPAC name | 3,4,5,6-tetrachloropyridin-2-amine |
| InChIKey | UNFHNOMCUBAGRI-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)N)Cl)Cl |
Computed by PubChem (NCBI)