Products 701-28-0
CAS 701-28-0 is the registry number for 2-Chloro-4-(trichloromethyl)pyrimidine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-chloro-4-(trichloromethyl)pyrimidine (CAS 701-28-0) is a chemical compound with the molecular formula C5H2Cl4N2 and a molecular weight of 231.9 g/mol. IUPAC name: 2-chloro-4-(trichloromethyl)pyrimidine. InChIKey: HHWQGPMDTJANOB-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl4N2 |
|---|---|
| Molecular weight | 231.9 g/mol |
| IUPAC name | 2-chloro-4-(trichloromethyl)pyrimidine |
| InChIKey | HHWQGPMDTJANOB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1C(Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)